C7H3F4IN2O3 — CID 155234464
2-fluoro-3-iodo-5-nitro-6-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 155234464) has the molecular formula C7H3F4IN2O3 and a molecular weight of 366.01 g/mol. Its IUPAC name is 2-fluoro-3-iodo-5-nitro-6-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 2-fluoro-3-iodo-5-nitro-6-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 155234464 |
| Molecular Formula | C7H3F4IN2O3 |
| Molecular Weight | 366.01 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | 2-fluoro-3-iodo-5-nitro-6-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | O=[N+]([O-])c1cc(I)c(F)nc1OCC(F)(F)F |
| InChI | InChI=1S/C7H3F4IN2O3/c8-5-3(12)1-4(14(15)16)6(13-5)17-2-7(9,10)11/h1H,2H2 |
| InChIKey | XVEUBHGUKARHCQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.01 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|