C8H7F3N4O4 — CID 103470634
N'-hydroxy-5-nitro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboximidamide (PubChem CID 103470634) has the molecular formula C8H7F3N4O4 and a molecular weight of 280.16 g/mol. Its IUPAC name is N'-hydroxy-5-nitro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-5-nitro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 103470634 |
| Molecular Formula | C8H7F3N4O4 |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N'-hydroxy-5-nitro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboximidamide |
| SMILES | NC(=NO)c1cnc(OCC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H7F3N4O4/c9-8(10,11)3-19-7-5(15(17)18)1-4(2-13-7)6(12)14-16/h1-2,16H,3H2,(H2,12,14) |
| InChIKey | WFTOKEIKUGGKBZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|