C8H7BrF2N2O4 — CID 146211557
3-[(5-bromo-3-nitro-2-pyridinyl)oxy]-2,2-difluoropropan-1-ol (PubChem CID 146211557) has the molecular formula C8H7BrF2N2O4 and a molecular weight of 313.05 g/mol. Its IUPAC name is 3-[(5-bromo-3-nitro-2-pyridinyl)oxy]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(5-bromo-3-nitro-2-pyridinyl)oxy]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 146211557 |
| Molecular Formula | C8H7BrF2N2O4 |
| Molecular Weight | 313.05 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 3-[(5-bromo-3-nitro-2-pyridinyl)oxy]-2,2-difluoropropan-1-ol |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1OCC(F)(F)CO |
| InChI | InChI=1S/C8H7BrF2N2O4/c9-5-1-6(13(15)16)7(12-2-5)17-4-8(10,11)3-14/h1-2,14H,3-4H2 |
| InChIKey | BJHTWVSGLJAEDC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.05 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|