C7H5BrF3N3O2 — CID 61229223
5-bromo-3-nitro-N-(2,2,2-trifluoroethyl)pyridin-2-amine (PubChem CID 61229223) has the molecular formula C7H5BrF3N3O2 and a molecular weight of 300.03 g/mol. Its IUPAC name is 5-bromo-3-nitro-N-(2,2,2-trifluoroethyl)pyridin-2-amine.
| Compound Name | 5-bromo-3-nitro-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 61229223 |
| Molecular Formula | C7H5BrF3N3O2 |
| Molecular Weight | 300.03 g/mol |
| Exact Mass | 298.95 |
| IUPAC Name | 5-bromo-3-nitro-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1NCC(F)(F)F |
| InChI | InChI=1S/C7H5BrF3N3O2/c8-4-1-5(14(15)16)6(12-2-4)13-3-7(9,10)11/h1-2H,3H2,(H,12,13) |
| InChIKey | KFDRAZAQYBSBSM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.03 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|