C8H10BrN3O3S — CID 97227168
5-bromo-N-[2-[(R)-methylsulfinyl]ethyl]-3-nitropyridin-2-amine (PubChem CID 97227168) has the molecular formula C8H10BrN3O3S and a molecular weight of 308.16 g/mol. Its IUPAC name is 5-bromo-N-[2-[(R)-methylsulfinyl]ethyl]-3-nitropyridin-2-amine.
| Compound Name | 5-bromo-N-[2-[(R)-methylsulfinyl]ethyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 97227168 |
| Molecular Formula | C8H10BrN3O3S |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 5-bromo-N-[2-[(R)-methylsulfinyl]ethyl]-3-nitropyridin-2-amine |
| SMILES | C[S@@](=O)CCNc1ncc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10BrN3O3S/c1-16(15)3-2-10-8-7(12(13)14)4-6(9)5-11-8/h4-5H,2-3H2,1H3,(H,10,11)/t16-/m1/s1 |
| InChIKey | DHHGXFWMEPMMQN-MRXNPFEDSA-N |
| XLogP | 1.54 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|