C13H12Br2ClN5O5 — CID 162205567
5-bromo-2-chloro-3-nitropyridine;1-[(5-bromo-3-nitro-2-pyridinyl)amino]propan-2-ol (PubChem CID 162205567) has the molecular formula C13H12Br2ClN5O5 and a molecular weight of 513.53 g/mol. Its IUPAC name is 5-bromo-2-chloro-3-nitropyridine;1-[(5-bromo-3-nitro-2-pyridinyl)amino]propan-2-ol.
| Compound Name | 5-bromo-2-chloro-3-nitropyridine;1-[(5-bromo-3-nitro-2-pyridinyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 162205567 |
| Molecular Formula | C13H12Br2ClN5O5 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 510.89 |
| IUPAC Name | 5-bromo-2-chloro-3-nitropyridine;1-[(5-bromo-3-nitro-2-pyridinyl)amino]propan-2-ol |
| SMILES | CC(O)CNc1ncc(Br)cc1[N+](=O)[O-].O=[N+]([O-])c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C8H10BrN3O3.C5H2BrClN2O2/c1-5(13)3-10-8-7(12(14)15)2-6(9)4-11-8;6-3-1-4(9(10)11)5(7)8-2-3/h2,4-5,13H,3H2,1H3,(H,10,11);1-2H |
| InChIKey | ZSDJSNGREDRRCY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|