C10H15N5O3 — CID 103470281
N'-hydroxy-6-[methyl(propyl)amino]-5-nitropyridine-3-carboximidamide (PubChem CID 103470281) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is N'-hydroxy-6-[methyl(propyl)amino]-5-nitropyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-6-[methyl(propyl)amino]-5-nitropyridine-3-carboximidamide |
|---|---|
| PubChem CID | 103470281 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N'-hydroxy-6-[methyl(propyl)amino]-5-nitropyridine-3-carboximidamide |
| SMILES | CCCN(C)c1ncc(C(N)=NO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N5O3/c1-3-4-14(2)10-8(15(17)18)5-7(6-12-10)9(11)13-16/h5-6,16H,3-4H2,1-2H3,(H2,11,13) |
| InChIKey | KPNNOBFLDOIXTA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|