C12H19N5O4 — CID 103470370
6-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-5-nitropyridine-3-carboximidamide (PubChem CID 103470370) has the molecular formula C12H19N5O4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 6-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-5-nitropyridine-3-carboximidamide.
| Compound Name | 6-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-5-nitropyridine-3-carboximidamide |
|---|---|
| PubChem CID | 103470370 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 6-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-5-nitropyridine-3-carboximidamide |
| SMILES | CCCCN(CCO)c1ncc(C(N)=NO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N5O4/c1-2-3-4-16(5-6-18)12-10(17(20)21)7-9(8-14-12)11(13)15-19/h7-8,18-19H,2-6H2,1H3,(H2,13,15) |
| InChIKey | BOJVXZDNOKKOIR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|