C12H19N5O3 — CID 76935186
N'-hydroxy-2-[methyl(pentyl)amino]-5-nitropyridine-3-carboximidamide (PubChem CID 76935186) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is N'-hydroxy-2-[methyl(pentyl)amino]-5-nitropyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-[methyl(pentyl)amino]-5-nitropyridine-3-carboximidamide |
|---|---|
| PubChem CID | 76935186 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N'-hydroxy-2-[methyl(pentyl)amino]-5-nitropyridine-3-carboximidamide |
| SMILES | CCCCCN(C)c1ncc([N+](=O)[O-])cc1C(N)=NO |
| InChI | InChI=1S/C12H19N5O3/c1-3-4-5-6-16(2)12-10(11(13)15-18)7-9(8-14-12)17(19)20/h7-8,18H,3-6H2,1-2H3,(H2,13,15) |
| InChIKey | IONIFIJMJDWHGL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|