C10H15N5O4 — CID 55060974
N'-hydroxy-2-[2-hydroxypropyl(methyl)amino]-5-nitropyridine-3-carboximidamide (PubChem CID 55060974) has the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. Its IUPAC name is N'-hydroxy-2-[2-hydroxypropyl(methyl)amino]-5-nitropyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-[2-hydroxypropyl(methyl)amino]-5-nitropyridine-3-carboximidamide |
|---|---|
| PubChem CID | 55060974 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N'-hydroxy-2-[2-hydroxypropyl(methyl)amino]-5-nitropyridine-3-carboximidamide |
| SMILES | CC(O)CN(C)c1ncc([N+](=O)[O-])cc1/C(N)=N/O |
| InChI | InChI=1S/C10H15N5O4/c1-6(16)5-14(2)10-8(9(11)13-17)3-7(4-12-10)15(18)19/h3-4,6,16-17H,5H2,1-2H3,(H2,11,13) |
| InChIKey | QSTHUUPCPKAOQL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|