C8H10N4O5 — CID 55037210
N'-hydroxy-2-(2-hydroxyethoxy)-5-nitropyridine-3-carboximidamide (PubChem CID 55037210) has the molecular formula C8H10N4O5 and a molecular weight of 242.19 g/mol. Its IUPAC name is N'-hydroxy-2-(2-hydroxyethoxy)-5-nitropyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-(2-hydroxyethoxy)-5-nitropyridine-3-carboximidamide |
|---|---|
| PubChem CID | 55037210 |
| Molecular Formula | C8H10N4O5 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N'-hydroxy-2-(2-hydroxyethoxy)-5-nitropyridine-3-carboximidamide |
| SMILES | N/C(=N/O)c1cc([N+](=O)[O-])cnc1OCCO |
| InChI | InChI=1S/C8H10N4O5/c9-7(11-14)6-3-5(12(15)16)4-10-8(6)17-2-1-13/h3-4,13-14H,1-2H2,(H2,9,11) |
| InChIKey | QDXKNBBUEYDAMS-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|