C12H18N4O4 — CID 77135490
2-(3,3-dimethylbutoxy)-N'-hydroxy-5-nitropyridine-3-carboximidamide (PubChem CID 77135490) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)-N'-hydroxy-5-nitropyridine-3-carboximidamide.
| Compound Name | 2-(3,3-dimethylbutoxy)-N'-hydroxy-5-nitropyridine-3-carboximidamide |
|---|---|
| PubChem CID | 77135490 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)-N'-hydroxy-5-nitropyridine-3-carboximidamide |
| SMILES | CC(C)(C)CCOc1ncc([N+](=O)[O-])cc1C(N)=NO |
| InChI | InChI=1S/C12H18N4O4/c1-12(2,3)4-5-20-11-9(10(13)15-17)6-8(7-14-11)16(18)19/h6-7,17H,4-5H2,1-3H3,(H2,13,15) |
| InChIKey | OFWDBQXKLLGWLH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|