C9H8N6O3 — CID 76935233
N'-hydroxy-5-nitro-2-pyrazol-1-ylpyridine-3-carboximidamide (PubChem CID 76935233) has the molecular formula C9H8N6O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is N'-hydroxy-5-nitro-2-pyrazol-1-ylpyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-5-nitro-2-pyrazol-1-ylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 76935233 |
| Molecular Formula | C9H8N6O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N'-hydroxy-5-nitro-2-pyrazol-1-ylpyridine-3-carboximidamide |
| SMILES | NC(=NO)c1cc([N+](=O)[O-])cnc1-n1cccn1 |
| InChI | InChI=1S/C9H8N6O3/c10-8(13-16)7-4-6(15(17)18)5-11-9(7)14-3-1-2-12-14/h1-5,16H,(H2,10,13) |
| InChIKey | VYFLNXUGARVZEC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|