C9H7N5O4S — CID 106922583
N'-hydroxy-5-nitro-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboximidamide (PubChem CID 106922583) has the molecular formula C9H7N5O4S and a molecular weight of 281.25 g/mol. Its IUPAC name is N'-hydroxy-5-nitro-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-5-nitro-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 106922583 |
| Molecular Formula | C9H7N5O4S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | N'-hydroxy-5-nitro-2-(1,3-oxazol-2-ylsulfanyl)pyridine-3-carboximidamide |
| SMILES | N/C(=N/O)c1cc([N+](=O)[O-])cnc1Sc1ncco1 |
| InChI | InChI=1S/C9H7N5O4S/c10-7(13-15)6-3-5(14(16)17)4-12-8(6)19-9-11-1-2-18-9/h1-4,15H,(H2,10,13) |
| InChIKey | BJKOBXOJBVZXEQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|