C9H10N4O4S — CID 79325838
N'-hydroxy-5-nitro-2-(oxetan-3-ylsulfanyl)pyridine-3-carboximidamide (PubChem CID 79325838) has the molecular formula C9H10N4O4S and a molecular weight of 270.27 g/mol. Its IUPAC name is N'-hydroxy-5-nitro-2-(oxetan-3-ylsulfanyl)pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-5-nitro-2-(oxetan-3-ylsulfanyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 79325838 |
| Molecular Formula | C9H10N4O4S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | N'-hydroxy-5-nitro-2-(oxetan-3-ylsulfanyl)pyridine-3-carboximidamide |
| SMILES | NC(=NO)c1cc([N+](=O)[O-])cnc1SC1COC1 |
| InChI | InChI=1S/C9H10N4O4S/c10-8(12-14)7-1-5(13(15)16)2-11-9(7)18-6-3-17-4-6/h1-2,6,14H,3-4H2,(H2,10,12) |
| InChIKey | OIASTSHVKRJBFU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|