C8H7N5O2S — CID 136914221
N'-hydroxy-3-(1,3-oxazol-2-ylsulfanyl)pyrazine-2-carboximidamide (PubChem CID 136914221) has the molecular formula C8H7N5O2S and a molecular weight of 237.24 g/mol. Its IUPAC name is N'-hydroxy-3-(1,3-oxazol-2-ylsulfanyl)pyrazine-2-carboximidamide.
| Compound Name | N'-hydroxy-3-(1,3-oxazol-2-ylsulfanyl)pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 136914221 |
| Molecular Formula | C8H7N5O2S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | N'-hydroxy-3-(1,3-oxazol-2-ylsulfanyl)pyrazine-2-carboximidamide |
| SMILES | N/C(=N/O)c1nccnc1Sc1ncco1 |
| InChI | InChI=1S/C8H7N5O2S/c9-6(13-14)5-7(11-2-1-10-5)16-8-12-3-4-15-8/h1-4,14H,(H2,9,13) |
| InChIKey | BIWOIKFIGGKYGG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|