C6H8N6O2 — CID 135525948
2-N',3-N'-dihydroxypyrazine-2,3-dicarboximidamide (PubChem CID 135525948) has the molecular formula C6H8N6O2 and a molecular weight of 196.17 g/mol. Its IUPAC name is 2-N',3-N'-dihydroxypyrazine-2,3-dicarboximidamide.
| Compound Name | 2-N',3-N'-dihydroxypyrazine-2,3-dicarboximidamide |
|---|---|
| PubChem CID | 135525948 |
| Molecular Formula | C6H8N6O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-N',3-N'-dihydroxypyrazine-2,3-dicarboximidamide |
| SMILES | NC(=NO)c1nccnc1C(N)=NO |
| InChI | InChI=1S/C6H8N6O2/c7-5(11-13)3-4(6(8)12-14)10-2-1-9-3/h1-2,13-14H,(H2,7,11)(H2,8,12) |
| InChIKey | GRXQEZFFGCAHKQ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|