C12H13N3O — CID 137085329
N'-hydroxy-5,7-dimethylisoquinoline-1-carboximidamide (PubChem CID 137085329) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is N'-hydroxy-5,7-dimethylisoquinoline-1-carboximidamide.
| Compound Name | N'-hydroxy-5,7-dimethylisoquinoline-1-carboximidamide |
|---|---|
| PubChem CID | 137085329 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N'-hydroxy-5,7-dimethylisoquinoline-1-carboximidamide |
| SMILES | Cc1cc(C)c2ccnc(C(N)=NO)c2c1 |
| InChI | InChI=1S/C12H13N3O/c1-7-5-8(2)9-3-4-14-11(10(9)6-7)12(13)15-16/h3-6,16H,1-2H3,(H2,13,15) |
| InChIKey | VHBURBGWVHDGBI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|