C10H7Cl2N3O — CID 137085334
5,6-dichloro-N'-hydroxyisoquinoline-1-carboximidamide (PubChem CID 137085334) has the molecular formula C10H7Cl2N3O and a molecular weight of 256.09 g/mol. Its IUPAC name is 5,6-dichloro-N'-hydroxyisoquinoline-1-carboximidamide.
| Compound Name | 5,6-dichloro-N'-hydroxyisoquinoline-1-carboximidamide |
|---|---|
| PubChem CID | 137085334 |
| Molecular Formula | C10H7Cl2N3O |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 5,6-dichloro-N'-hydroxyisoquinoline-1-carboximidamide |
| SMILES | NC(=NO)c1nccc2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C10H7Cl2N3O/c11-7-2-1-6-5(8(7)12)3-4-14-9(6)10(13)15-16/h1-4,16H,(H2,13,15) |
| InChIKey | WOUMMNQUJQXPDQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|