C9H8ClN5OS — CID 136778508
3-chloro-N'-hydroxy-2-(1H-imidazol-2-ylsulfanyl)pyridine-4-carboximidamide (PubChem CID 136778508) has the molecular formula C9H8ClN5OS and a molecular weight of 269.72 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-2-(1H-imidazol-2-ylsulfanyl)pyridine-4-carboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-2-(1H-imidazol-2-ylsulfanyl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136778508 |
| Molecular Formula | C9H8ClN5OS |
| Molecular Weight | 269.72 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 3-chloro-N'-hydroxy-2-(1H-imidazol-2-ylsulfanyl)pyridine-4-carboximidamide |
| SMILES | N/C(=N/O)c1ccnc(Sc2ncc[nH]2)c1Cl |
| InChI | InChI=1S/C9H8ClN5OS/c10-6-5(7(11)15-16)1-2-12-8(6)17-9-13-3-4-14-9/h1-4,16H,(H2,11,15)(H,13,14) |
| InChIKey | DNFBUZSEHXGWQU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.72 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|