C11H8BrClN4OS — CID 136739874
2-[(3-bromo-2-pyridinyl)sulfanyl]-3-chloro-N'-hydroxypyridine-4-carboximidamide (PubChem CID 136739874) has the molecular formula C11H8BrClN4OS and a molecular weight of 359.64 g/mol. Its IUPAC name is 2-[(3-bromo-2-pyridinyl)sulfanyl]-3-chloro-N'-hydroxypyridine-4-carboximidamide.
| Compound Name | 2-[(3-bromo-2-pyridinyl)sulfanyl]-3-chloro-N'-hydroxypyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136739874 |
| Molecular Formula | C11H8BrClN4OS |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | 2-[(3-bromo-2-pyridinyl)sulfanyl]-3-chloro-N'-hydroxypyridine-4-carboximidamide |
| SMILES | N/C(=N/O)c1ccnc(Sc2ncccc2Br)c1Cl |
| InChI | InChI=1S/C11H8BrClN4OS/c12-7-2-1-4-15-10(7)19-11-8(13)6(3-5-16-11)9(14)17-18/h1-5,18H,(H2,14,17) |
| InChIKey | HHSHRIPGDSEHAY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|