C11H11ClN6O2S — CID 136739865
3-chloro-2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxypyridine-4-carboximidamide (PubChem CID 136739865) has the molecular formula C11H11ClN6O2S and a molecular weight of 326.77 g/mol. Its IUPAC name is 3-chloro-2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxypyridine-4-carboximidamide.
| Compound Name | 3-chloro-2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxypyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136739865 |
| Molecular Formula | C11H11ClN6O2S |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3-chloro-2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxypyridine-4-carboximidamide |
| SMILES | N/C(=N/O)c1ccnc(Sc2n[nH]c(=O)n2C2CC2)c1Cl |
| InChI | InChI=1S/C11H11ClN6O2S/c12-7-6(8(13)17-20)3-4-14-9(7)21-11-16-15-10(19)18(11)5-1-2-5/h3-5,20H,1-2H2,(H2,13,17)(H,15,19) |
| InChIKey | VYRMOBSKZSMDGG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|