C12H13ClN4OS — CID 136739301
3-chloro-N'-hydroxy-2-[methyl(thiophen-3-ylmethyl)amino]pyridine-4-carboximidamide (PubChem CID 136739301) has the molecular formula C12H13ClN4OS and a molecular weight of 296.78 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-2-[methyl(thiophen-3-ylmethyl)amino]pyridine-4-carboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-2-[methyl(thiophen-3-ylmethyl)amino]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136739301 |
| Molecular Formula | C12H13ClN4OS |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-chloro-N'-hydroxy-2-[methyl(thiophen-3-ylmethyl)amino]pyridine-4-carboximidamide |
| SMILES | CN(Cc1ccsc1)c1nccc(/C(N)=N/O)c1Cl |
| InChI | InChI=1S/C12H13ClN4OS/c1-17(6-8-3-5-19-7-8)12-10(13)9(2-4-15-12)11(14)16-18/h2-5,7,18H,6H2,1H3,(H2,14,16) |
| InChIKey | PCUDKZBGXQBALH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|