C14H22ClN5O — CID 136739403
3-chloro-2-[(1-ethylpiperidin-4-yl)-methylamino]-N'-hydroxypyridine-4-carboximidamide (PubChem CID 136739403) has the molecular formula C14H22ClN5O and a molecular weight of 311.82 g/mol. Its IUPAC name is 3-chloro-2-[(1-ethylpiperidin-4-yl)-methylamino]-N'-hydroxypyridine-4-carboximidamide.
| Compound Name | 3-chloro-2-[(1-ethylpiperidin-4-yl)-methylamino]-N'-hydroxypyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136739403 |
| Molecular Formula | C14H22ClN5O |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-chloro-2-[(1-ethylpiperidin-4-yl)-methylamino]-N'-hydroxypyridine-4-carboximidamide |
| SMILES | CCN1CCC(N(C)c2nccc(/C(N)=N/O)c2Cl)CC1 |
| InChI | InChI=1S/C14H22ClN5O/c1-3-20-8-5-10(6-9-20)19(2)14-12(15)11(4-7-17-14)13(16)18-21/h4,7,10,21H,3,5-6,8-9H2,1-2H3,(H2,16,18) |
| InChIKey | XTSQHILWLQOUGH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|