C12H19ClN4OS — CID 136739556
3-chloro-N'-hydroxy-2-[methyl(4-methylsulfanylbutan-2-yl)amino]pyridine-4-carboximidamide (PubChem CID 136739556) has the molecular formula C12H19ClN4OS and a molecular weight of 302.83 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-2-[methyl(4-methylsulfanylbutan-2-yl)amino]pyridine-4-carboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-2-[methyl(4-methylsulfanylbutan-2-yl)amino]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136739556 |
| Molecular Formula | C12H19ClN4OS |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-chloro-N'-hydroxy-2-[methyl(4-methylsulfanylbutan-2-yl)amino]pyridine-4-carboximidamide |
| SMILES | CSCCC(C)N(C)c1nccc(/C(N)=N/O)c1Cl |
| InChI | InChI=1S/C12H19ClN4OS/c1-8(5-7-19-3)17(2)12-10(13)9(4-6-15-12)11(14)16-18/h4,6,8,18H,5,7H2,1-3H3,(H2,14,16) |
| InChIKey | ZLYOTIJXKZMXBZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|