C13H20BrN3OS — CID 114883355
2-bromo-N'-hydroxy-6-[methyl(4-methylsulfanylbutan-2-yl)amino]benzenecarboximidamide (PubChem CID 114883355) has the molecular formula C13H20BrN3OS and a molecular weight of 346.29 g/mol. Its IUPAC name is 2-bromo-N'-hydroxy-6-[methyl(4-methylsulfanylbutan-2-yl)amino]benzenecarboximidamide.
| Compound Name | 2-bromo-N'-hydroxy-6-[methyl(4-methylsulfanylbutan-2-yl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 114883355 |
| Molecular Formula | C13H20BrN3OS |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-bromo-N'-hydroxy-6-[methyl(4-methylsulfanylbutan-2-yl)amino]benzenecarboximidamide |
| SMILES | CSCCC(C)N(C)c1cccc(Br)c1/C(N)=N/O |
| InChI | InChI=1S/C13H20BrN3OS/c1-9(7-8-19-3)17(2)11-6-4-5-10(14)12(11)13(15)16-18/h4-6,9,18H,7-8H2,1-3H3,(H2,15,16) |
| InChIKey | LURAZHOGKIZZMT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|