C8H4Cl3N3S — CID 107780767
2,3,5-trichloro-6-(1H-imidazol-2-ylsulfanyl)pyridine (PubChem CID 107780767) has the molecular formula C8H4Cl3N3S and a molecular weight of 280.57 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(1H-imidazol-2-ylsulfanyl)pyridine.
| Compound Name | 2,3,5-trichloro-6-(1H-imidazol-2-ylsulfanyl)pyridine |
|---|---|
| PubChem CID | 107780767 |
| Molecular Formula | C8H4Cl3N3S |
| Molecular Weight | 280.57 g/mol |
| Exact Mass | 278.92 |
| IUPAC Name | 2,3,5-trichloro-6-(1H-imidazol-2-ylsulfanyl)pyridine |
| SMILES | Clc1cc(Cl)c(Sc2ncc[nH]2)nc1Cl |
| InChI | InChI=1S/C8H4Cl3N3S/c9-4-3-5(10)7(14-6(4)11)15-8-12-1-2-13-8/h1-3H,(H,12,13) |
| InChIKey | QOHKUTLXSNXFPM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|