C11H12N4OS — CID 107780293
N'-hydroxy-4-(1H-imidazol-2-ylsulfanylmethyl)benzenecarboximidamide (PubChem CID 107780293) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is N'-hydroxy-4-(1H-imidazol-2-ylsulfanylmethyl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-(1H-imidazol-2-ylsulfanylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107780293 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N'-hydroxy-4-(1H-imidazol-2-ylsulfanylmethyl)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(CSc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C11H12N4OS/c12-10(15-16)9-3-1-8(2-4-9)7-17-11-13-5-6-14-11/h1-6,16H,7H2,(H2,12,15)(H,13,14) |
| InChIKey | KVBIOMVKTODTIF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|