C11H10N2O2S2 — CID 10171532
4-[(1H-imidazol-2-yldisulfanyl)methyl]benzoic acid (PubChem CID 10171532) has the molecular formula C11H10N2O2S2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 4-[(1H-imidazol-2-yldisulfanyl)methyl]benzoic acid.
| Compound Name | 4-[(1H-imidazol-2-yldisulfanyl)methyl]benzoic acid |
|---|---|
| PubChem CID | 10171532 |
| Molecular Formula | C11H10N2O2S2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 4-[(1H-imidazol-2-yldisulfanyl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CSSc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C11H10N2O2S2/c14-10(15)9-3-1-8(2-4-9)7-16-17-11-12-5-6-13-11/h1-6H,7H2,(H,12,13)(H,14,15) |
| InChIKey | CQIPWBPSPHSRAB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|