C15H22N2O3SSi — CID 58868338
2-[4-(1H-imidazol-2-ylsulfanylmethyl)phenyl]ethyl-trimethoxysilane (PubChem CID 58868338) has the molecular formula C15H22N2O3SSi and a molecular weight of 338.51 g/mol. Its IUPAC name is 2-[4-(1H-imidazol-2-ylsulfanylmethyl)phenyl]ethyl-trimethoxysilane.
| Compound Name | 2-[4-(1H-imidazol-2-ylsulfanylmethyl)phenyl]ethyl-trimethoxysilane |
|---|---|
| PubChem CID | 58868338 |
| Molecular Formula | C15H22N2O3SSi |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-[4-(1H-imidazol-2-ylsulfanylmethyl)phenyl]ethyl-trimethoxysilane |
| SMILES | CO[Si](CCc1ccc(CSc2ncc[nH]2)cc1)(OC)OC |
| InChI | InChI=1S/C15H22N2O3SSi/c1-18-22(19-2,20-3)11-8-13-4-6-14(7-5-13)12-21-15-16-9-10-17-15/h4-7,9-10H,8,11-12H2,1-3H3,(H,16,17) |
| InChIKey | GZPPSVCLWKPVOX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|