C10H10BrN3S — CID 107779694
2-bromo-5-(1H-imidazol-2-ylsulfanylmethyl)aniline (PubChem CID 107779694) has the molecular formula C10H10BrN3S and a molecular weight of 284.18 g/mol. Its IUPAC name is 2-bromo-5-(1H-imidazol-2-ylsulfanylmethyl)aniline.
| Compound Name | 2-bromo-5-(1H-imidazol-2-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 107779694 |
| Molecular Formula | C10H10BrN3S |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 2-bromo-5-(1H-imidazol-2-ylsulfanylmethyl)aniline |
| SMILES | Nc1cc(CSc2ncc[nH]2)ccc1Br |
| InChI | InChI=1S/C10H10BrN3S/c11-8-2-1-7(5-9(8)12)6-15-10-13-3-4-14-10/h1-5H,6,12H2,(H,13,14) |
| InChIKey | HSUMDPRBLPWRGG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|