C10H14BrNO2S — CID 115558397
3-[(3-amino-4-bromophenyl)methylsulfanyl]propane-1,2-diol (PubChem CID 115558397) has the molecular formula C10H14BrNO2S and a molecular weight of 292.20 g/mol. Its IUPAC name is 3-[(3-amino-4-bromophenyl)methylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[(3-amino-4-bromophenyl)methylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 115558397 |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 3-[(3-amino-4-bromophenyl)methylsulfanyl]propane-1,2-diol |
| SMILES | Nc1cc(CSCC(O)CO)ccc1Br |
| InChI | InChI=1S/C10H14BrNO2S/c11-9-2-1-7(3-10(9)12)5-15-6-8(14)4-13/h1-3,8,13-14H,4-6,12H2 |
| InChIKey | YDXRJYUTOIJWFB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|