C11H17NO3S — CID 81154694
3-[(3-amino-5-methoxyphenyl)methylsulfanyl]propane-1,2-diol (PubChem CID 81154694) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-[(3-amino-5-methoxyphenyl)methylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[(3-amino-5-methoxyphenyl)methylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 81154694 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-[(3-amino-5-methoxyphenyl)methylsulfanyl]propane-1,2-diol |
| SMILES | COc1cc(N)cc(CSCC(O)CO)c1 |
| InChI | InChI=1S/C11H17NO3S/c1-15-11-3-8(2-9(12)4-11)6-16-7-10(14)5-13/h2-4,10,13-14H,5-7,12H2,1H3 |
| InChIKey | ZPVUHFDLYBNTKB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|