C10H15O2S2+ — CID 143928964
[4-(2,3-dihydroxypropylsulfanylmethyl)phenyl]sulfanium (PubChem CID 143928964) has the molecular formula C10H15O2S2+ and a molecular weight of 231.36 g/mol. Its IUPAC name is [4-(2,3-dihydroxypropylsulfanylmethyl)phenyl]sulfanium.
| Compound Name | [4-(2,3-dihydroxypropylsulfanylmethyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 143928964 |
| Molecular Formula | C10H15O2S2+ |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | [4-(2,3-dihydroxypropylsulfanylmethyl)phenyl]sulfanium |
| SMILES | OCC(O)CSCc1ccc([SH2+])cc1 |
| InChI | InChI=1S/C10H14O2S2/c11-5-9(12)7-14-6-8-1-3-10(13)4-2-8/h1-4,9,11-13H,5-7H2/p+1 |
| InChIKey | LWMPKIUFRBZSGA-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|