C10H13BrO2S — CID 78912115
3-[(4-bromophenyl)methylsulfanyl]propane-1,2-diol (PubChem CID 78912115) has the molecular formula C10H13BrO2S and a molecular weight of 277.18 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[(4-bromophenyl)methylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 78912115 |
| Molecular Formula | C10H13BrO2S |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 3-[(4-bromophenyl)methylsulfanyl]propane-1,2-diol |
| SMILES | OCC(O)CSCc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H13BrO2S/c11-9-3-1-8(2-4-9)6-14-7-10(13)5-12/h1-4,10,12-13H,5-7H2 |
| InChIKey | ZRJLUBFBZFKATE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |