C10H12Cl2O2S — CID 97049217
(2S)-3-[(3,4-dichlorophenyl)methylsulfanyl]propane-1,2-diol (PubChem CID 97049217) has the molecular formula C10H12Cl2O2S and a molecular weight of 267.18 g/mol. Its IUPAC name is (2S)-3-[(3,4-dichlorophenyl)methylsulfanyl]propane-1,2-diol.
| Compound Name | (2S)-3-[(3,4-dichlorophenyl)methylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 97049217 |
| Molecular Formula | C10H12Cl2O2S |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | (2S)-3-[(3,4-dichlorophenyl)methylsulfanyl]propane-1,2-diol |
| SMILES | OC[C@H](O)CSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2O2S/c11-9-2-1-7(3-10(9)12)5-15-6-8(14)4-13/h1-3,8,13-14H,4-6H2/t8-/m0/s1 |
| InChIKey | XWTWOORCNNLVOU-QMMMGPOBSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |