C11H14Cl2OS — CID 65130613
1-(3,4-dichlorophenyl)-3-ethylsulfanylpropan-2-ol (PubChem CID 65130613) has the molecular formula C11H14Cl2OS and a molecular weight of 265.20 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-ethylsulfanylpropan-2-ol.
| Compound Name | 1-(3,4-dichlorophenyl)-3-ethylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 65130613 |
| Molecular Formula | C11H14Cl2OS |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-ethylsulfanylpropan-2-ol |
| SMILES | CCSCC(O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2OS/c1-2-15-7-9(14)5-8-3-4-10(12)11(13)6-8/h3-4,6,9,14H,2,5,7H2,1H3 |
| InChIKey | HEPWJCYCCPMRIN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |