C14H14Cl2O2 — CID 114103870
2-(3,4-dichlorophenyl)-1-(2-ethylfuran-3-yl)ethanol (PubChem CID 114103870) has the molecular formula C14H14Cl2O2 and a molecular weight of 285.17 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(2-ethylfuran-3-yl)ethanol.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(2-ethylfuran-3-yl)ethanol |
|---|---|
| PubChem CID | 114103870 |
| Molecular Formula | C14H14Cl2O2 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(2-ethylfuran-3-yl)ethanol |
| SMILES | CCc1occc1C(O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2O2/c1-2-14-10(5-6-18-14)13(17)8-9-3-4-11(15)12(16)7-9/h3-7,13,17H,2,8H2,1H3 |
| InChIKey | WNYDKCLLTKFQAP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |