C14H13ClF2O — CID 114103882
3-[1-chloro-2-(3,4-difluorophenyl)ethyl]-2-ethylfuran (PubChem CID 114103882) has the molecular formula C14H13ClF2O and a molecular weight of 270.71 g/mol. Its IUPAC name is 3-[1-chloro-2-(3,4-difluorophenyl)ethyl]-2-ethylfuran.
| Compound Name | 3-[1-chloro-2-(3,4-difluorophenyl)ethyl]-2-ethylfuran |
|---|---|
| PubChem CID | 114103882 |
| Molecular Formula | C14H13ClF2O |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-[1-chloro-2-(3,4-difluorophenyl)ethyl]-2-ethylfuran |
| SMILES | CCc1occc1C(Cl)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H13ClF2O/c1-2-14-10(5-6-18-14)11(15)7-9-3-4-12(16)13(17)8-9/h3-6,8,11H,2,7H2,1H3 |
| InChIKey | YOMVDPUUAAMFNM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|