C14H14Cl2O3 — CID 106689725
2-chloro-3-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]furan (PubChem CID 106689725) has the molecular formula C14H14Cl2O3 and a molecular weight of 301.17 g/mol. Its IUPAC name is 2-chloro-3-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]furan.
| Compound Name | 2-chloro-3-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]furan |
|---|---|
| PubChem CID | 106689725 |
| Molecular Formula | C14H14Cl2O3 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-chloro-3-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]furan |
| SMILES | COc1ccc(CC(Cl)c2ccoc2Cl)cc1OC |
| InChI | InChI=1S/C14H14Cl2O3/c1-17-12-4-3-9(8-13(12)18-2)7-11(15)10-5-6-19-14(10)16/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | DTFBVEFEDBLFQS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|