C15H17BrO3 — CID 63017419
3-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]-2-methylfuran (PubChem CID 63017419) has the molecular formula C15H17BrO3 and a molecular weight of 325.20 g/mol. Its IUPAC name is 3-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]-2-methylfuran.
| Compound Name | 3-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]-2-methylfuran |
|---|---|
| PubChem CID | 63017419 |
| Molecular Formula | C15H17BrO3 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 3-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]-2-methylfuran |
| SMILES | COc1ccc(CC(Br)c2ccoc2C)cc1OC |
| InChI | InChI=1S/C15H17BrO3/c1-10-12(6-7-19-10)13(16)8-11-4-5-14(17-2)15(9-11)18-3/h4-7,9,13H,8H2,1-3H3 |
| InChIKey | SBFDBXQRHHFQLM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|