C17H19BrO — CID 63543083
4-[2-bromo-2-(2-methoxyphenyl)ethyl]-1,2-dimethylbenzene (PubChem CID 63543083) has the molecular formula C17H19BrO and a molecular weight of 319.24 g/mol. Its IUPAC name is 4-[2-bromo-2-(2-methoxyphenyl)ethyl]-1,2-dimethylbenzene.
| Compound Name | 4-[2-bromo-2-(2-methoxyphenyl)ethyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 63543083 |
| Molecular Formula | C17H19BrO |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-[2-bromo-2-(2-methoxyphenyl)ethyl]-1,2-dimethylbenzene |
| SMILES | COc1ccccc1C(Br)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H19BrO/c1-12-8-9-14(10-13(12)2)11-16(18)15-6-4-5-7-17(15)19-3/h4-10,16H,11H2,1-3H3 |
| InChIKey | JXGXNJMCPVVBSZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|