C17H18Br2O — CID 63435707
2-bromo-4-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-1-methoxybenzene (PubChem CID 63435707) has the molecular formula C17H18Br2O and a molecular weight of 398.14 g/mol. Its IUPAC name is 2-bromo-4-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-1-methoxybenzene.
| Compound Name | 2-bromo-4-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-1-methoxybenzene |
|---|---|
| PubChem CID | 63435707 |
| Molecular Formula | C17H18Br2O |
| Molecular Weight | 398.14 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 2-bromo-4-[1-bromo-2-(3,4-dimethylphenyl)ethyl]-1-methoxybenzene |
| SMILES | COc1ccc(C(Br)Cc2ccc(C)c(C)c2)cc1Br |
| InChI | InChI=1S/C17H18Br2O/c1-11-4-5-13(8-12(11)2)9-15(18)14-6-7-17(20-3)16(19)10-14/h4-8,10,15H,9H2,1-3H3 |
| InChIKey | YLIAHJLRPPHDKS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.14 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|