C20H25Br — CID 115483070
4-[2-bromo-2-(3,4-diethylphenyl)ethyl]-1,2-dimethylbenzene (PubChem CID 115483070) has the molecular formula C20H25Br and a molecular weight of 345.32 g/mol. Its IUPAC name is 4-[2-bromo-2-(3,4-diethylphenyl)ethyl]-1,2-dimethylbenzene.
| Compound Name | 4-[2-bromo-2-(3,4-diethylphenyl)ethyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 115483070 |
| Molecular Formula | C20H25Br |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4-[2-bromo-2-(3,4-diethylphenyl)ethyl]-1,2-dimethylbenzene |
| SMILES | CCc1ccc(C(Br)Cc2ccc(C)c(C)c2)cc1CC |
| InChI | InChI=1S/C20H25Br/c1-5-17-9-10-19(13-18(17)6-2)20(21)12-16-8-7-14(3)15(4)11-16/h7-11,13,20H,5-6,12H2,1-4H3 |
| InChIKey | AYLFXEDWURFAKZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|