C18H20BrF — CID 115482997
4-[1-bromo-2-(4-fluorophenyl)ethyl]-1,2-diethylbenzene (PubChem CID 115482997) has the molecular formula C18H20BrF and a molecular weight of 335.26 g/mol. Its IUPAC name is 4-[1-bromo-2-(4-fluorophenyl)ethyl]-1,2-diethylbenzene.
| Compound Name | 4-[1-bromo-2-(4-fluorophenyl)ethyl]-1,2-diethylbenzene |
|---|---|
| PubChem CID | 115482997 |
| Molecular Formula | C18H20BrF |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-[1-bromo-2-(4-fluorophenyl)ethyl]-1,2-diethylbenzene |
| SMILES | CCc1ccc(C(Br)Cc2ccc(F)cc2)cc1CC |
| InChI | InChI=1S/C18H20BrF/c1-3-14-7-8-16(12-15(14)4-2)18(19)11-13-5-9-17(20)10-6-13/h5-10,12,18H,3-4,11H2,1-2H3 |
| InChIKey | DTCBGRATNQCADO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|