C15H13BrF2 — CID 55218629
4-[1-bromo-2-(4-methylphenyl)ethyl]-1,2-difluorobenzene (PubChem CID 55218629) has the molecular formula C15H13BrF2 and a molecular weight of 311.17 g/mol. Its IUPAC name is 4-[1-bromo-2-(4-methylphenyl)ethyl]-1,2-difluorobenzene.
| Compound Name | 4-[1-bromo-2-(4-methylphenyl)ethyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 55218629 |
| Molecular Formula | C15H13BrF2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 4-[1-bromo-2-(4-methylphenyl)ethyl]-1,2-difluorobenzene |
| SMILES | Cc1ccc(CC(Br)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H13BrF2/c1-10-2-4-11(5-3-10)8-13(16)12-6-7-14(17)15(18)9-12/h2-7,9,13H,8H2,1H3 |
| InChIKey | PKNWMOBISIUNGK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|