C15H12BrCl2F — CID 63531447
4-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-2-fluoro-1-methylbenzene (PubChem CID 63531447) has the molecular formula C15H12BrCl2F and a molecular weight of 362.07 g/mol. Its IUPAC name is 4-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-2-fluoro-1-methylbenzene.
| Compound Name | 4-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-2-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 63531447 |
| Molecular Formula | C15H12BrCl2F |
| Molecular Weight | 362.07 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 4-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-2-fluoro-1-methylbenzene |
| SMILES | Cc1ccc(C(Br)Cc2ccc(Cl)c(Cl)c2)cc1F |
| InChI | InChI=1S/C15H12BrCl2F/c1-9-2-4-11(8-15(9)19)12(16)6-10-3-5-13(17)14(18)7-10/h2-5,7-8,12H,6H2,1H3 |
| InChIKey | DSKRAANYXRRNIE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.07 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|