C14H9Br2Cl3 — CID 107993456
2-bromo-4-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-1-chlorobenzene (PubChem CID 107993456) has the molecular formula C14H9Br2Cl3 and a molecular weight of 443.39 g/mol. Its IUPAC name is 2-bromo-4-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-1-chlorobenzene.
| Compound Name | 2-bromo-4-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-1-chlorobenzene |
|---|---|
| PubChem CID | 107993456 |
| Molecular Formula | C14H9Br2Cl3 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 439.81 |
| IUPAC Name | 2-bromo-4-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-1-chlorobenzene |
| SMILES | Clc1ccc(CC(Br)c2ccc(Cl)c(Br)c2)cc1Cl |
| InChI | InChI=1S/C14H9Br2Cl3/c15-10(9-2-4-12(17)11(16)7-9)5-8-1-3-13(18)14(19)6-8/h1-4,6-7,10H,5H2 |
| InChIKey | HQWCIMMVQRDLDJ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|