C14H9BrCl4 — CID 63529429
1-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-3,5-dichlorobenzene (PubChem CID 63529429) has the molecular formula C14H9BrCl4 and a molecular weight of 398.94 g/mol. Its IUPAC name is 1-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-3,5-dichlorobenzene.
| Compound Name | 1-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-3,5-dichlorobenzene |
|---|---|
| PubChem CID | 63529429 |
| Molecular Formula | C14H9BrCl4 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 395.86 |
| IUPAC Name | 1-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-3,5-dichlorobenzene |
| SMILES | Clc1cc(Cl)cc(C(Br)Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H9BrCl4/c15-12(9-5-10(16)7-11(17)6-9)3-8-1-2-13(18)14(19)4-8/h1-2,4-7,12H,3H2 |
| InChIKey | AMVPQISLWVPVPR-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|