C14H10BrCl3 — CID 63437197
4-[2-bromo-2-(4-chlorophenyl)ethyl]-1,2-dichlorobenzene (PubChem CID 63437197) has the molecular formula C14H10BrCl3 and a molecular weight of 364.50 g/mol. Its IUPAC name is 4-[2-bromo-2-(4-chlorophenyl)ethyl]-1,2-dichlorobenzene.
| Compound Name | 4-[2-bromo-2-(4-chlorophenyl)ethyl]-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 63437197 |
| Molecular Formula | C14H10BrCl3 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | 4-[2-bromo-2-(4-chlorophenyl)ethyl]-1,2-dichlorobenzene |
| SMILES | Clc1ccc(C(Br)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C14H10BrCl3/c15-12(10-2-4-11(16)5-3-10)7-9-1-6-13(17)14(18)8-9/h1-6,8,12H,7H2 |
| InChIKey | KGGNHNPVYIXMFI-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|